C23H23N3 — CID 145334870
(1E,3Z)-1-[2-[1-(naphthalen-1-ylamino)ethenyl]phenyl]penta-1,3-diene-1,2-diamine (PubChem CID 145334870) has the molecular formula C23H23N3 and a molecular weight of 341.46 g/mol. Its IUPAC name is (1E,3Z)-1-[2-[1-(naphthalen-1-ylamino)ethenyl]phenyl]penta-1,3-diene-1,2-diamine.
| Compound Name | (1E,3Z)-1-[2-[1-(naphthalen-1-ylamino)ethenyl]phenyl]penta-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 145334870 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (1E,3Z)-1-[2-[1-(naphthalen-1-ylamino)ethenyl]phenyl]penta-1,3-diene-1,2-diamine |
| SMILES | C=C(Nc1cccc2ccccc12)c1ccccc1/C(N)=C(N)/C=C\C |
| InChI | InChI=1S/C23H23N3/c1-3-9-21(24)23(25)20-14-7-6-12-18(20)16(2)26-22-15-8-11-17-10-4-5-13-19(17)22/h3-15,26H,2,24-25H2,1H3/b9-3-,23-21+ |
| InChIKey | HOHYWXOMJAUDCH-SQCHOXKGSA-N |
| XLogP | 5.08 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|