C14H16N2O3S — CID 135224786
N-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfamoyl]phenyl]formamide (PubChem CID 135224786) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfamoyl]phenyl]formamide.
| Compound Name | N-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfamoyl]phenyl]formamide |
|---|---|
| PubChem CID | 135224786 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfamoyl]phenyl]formamide |
| SMILES | C=C/C=C(\C=C/C)NS(=O)(=O)c1ccc(NC=O)cc1 |
| InChI | InChI=1S/C14H16N2O3S/c1-3-5-13(6-4-2)16-20(18,19)14-9-7-12(8-10-14)15-11-17/h3-11,16H,1H2,2H3,(H,15,17)/b6-4-,13-5+ |
| InChIKey | CGSLTXXNNLWHGP-GLRUQPRCSA-N |
| XLogP | 2.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|