C10H11N3O3S2 — CID 168652188
N-[4-(4,5-dihydro-1,3-thiazol-2-ylsulfamoyl)phenyl]formamide (PubChem CID 168652188) has the molecular formula C10H11N3O3S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[4-(4,5-dihydro-1,3-thiazol-2-ylsulfamoyl)phenyl]formamide.
| Compound Name | N-[4-(4,5-dihydro-1,3-thiazol-2-ylsulfamoyl)phenyl]formamide |
|---|---|
| PubChem CID | 168652188 |
| Molecular Formula | C10H11N3O3S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | N-[4-(4,5-dihydro-1,3-thiazol-2-ylsulfamoyl)phenyl]formamide |
| SMILES | O=CNc1ccc(S(=O)(=O)NC2=NCCS2)cc1 |
| InChI | InChI=1S/C10H11N3O3S2/c14-7-12-8-1-3-9(4-2-8)18(15,16)13-10-11-5-6-17-10/h1-4,7H,5-6H2,(H,11,13)(H,12,14) |
| InChIKey | PABHTAVPUIDAFD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|