C11H15N3O2S2 — CID 54995967
4-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)ethyl]benzenesulfonamide (PubChem CID 54995967) has the molecular formula C11H15N3O2S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54995967 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-[2-(4,5-dihydro-1,3-thiazol-2-ylamino)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC2=NCCS2)cc1 |
| InChI | InChI=1S/C11H15N3O2S2/c12-18(15,16)10-3-1-9(2-4-10)5-6-13-11-14-7-8-17-11/h1-4H,5-8H2,(H,13,14)(H2,12,15,16) |
| InChIKey | IWRLMOSSCHMWMA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |