C12H16ClN3O3S2 — CID 168639882
4-[(3-chloro-2-hydroxypropyl)amino]-N-(4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 168639882) has the molecular formula C12H16ClN3O3S2 and a molecular weight of 349.87 g/mol. Its IUPAC name is 4-[(3-chloro-2-hydroxypropyl)amino]-N-(4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[(3-chloro-2-hydroxypropyl)amino]-N-(4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 168639882 |
| Molecular Formula | C12H16ClN3O3S2 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 4-[(3-chloro-2-hydroxypropyl)amino]-N-(4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1=NCCS1)c1ccc(NCC(O)CCl)cc1 |
| InChI | InChI=1S/C12H16ClN3O3S2/c13-7-10(17)8-15-9-1-3-11(4-2-9)21(18,19)16-12-14-5-6-20-12/h1-4,10,15,17H,5-8H2,(H,14,16) |
| InChIKey | JRNGKISWAOOKDF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|