C45H44N2 — CID 146384735
4-cyclohexa-1,5-dien-1-yl-2-[4-[1-[4-(3,4-dihydronaphthalen-1-yl)phenyl]cyclohexyl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrimidine (PubChem CID 146384735) has the molecular formula C45H44N2 and a molecular weight of 612.86 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-2-[4-[1-[4-(3,4-dihydronaphthalen-1-yl)phenyl]cyclohexyl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrimidine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-2-[4-[1-[4-(3,4-dihydronaphthalen-1-yl)phenyl]cyclohexyl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrimidine |
|---|---|
| PubChem CID | 146384735 |
| Molecular Formula | C45H44N2 |
| Molecular Weight | 612.86 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-2-[4-[1-[4-(3,4-dihydronaphthalen-1-yl)phenyl]cyclohexyl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrimidine |
| SMILES | C=C/C=C(\C=C/C)c1cc(C2=CCCC=C2)nc(-c2ccc(C3(c4ccc(C5=CCCc6ccccc65)cc4)CCCCC3)cc2)n1 |
| InChI | InChI=1S/C45H44N2/c1-3-14-35(15-4-2)42-32-43(36-17-7-5-8-18-36)47-44(46-42)37-24-28-39(29-25-37)45(30-11-6-12-31-45)38-26-22-34(23-27-38)41-21-13-19-33-16-9-10-20-40(33)41/h3-4,7,9-10,14-18,20-29,32H,1,5-6,8,11-13,19,30-31H2,2H3/b15-4-,35-14+ |
| InChIKey | HNEFKPCFYIYTQO-JQGNZYGMSA-N |
| XLogP | 11.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.86 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|