C28H32BN3O2 — CID 172612946
2-cyclohexa-1,5-dien-1-yl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 172612946) has the molecular formula C28H32BN3O2 and a molecular weight of 453.40 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 172612946 |
| Molecular Formula | C28H32BN3O2 |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C/C)c1nc(C2=CCCC=C2)nc(-c2cccc(B3OC(C)(C)C(C)(C)O3)c2)n1 |
| InChI | InChI=1S/C28H32BN3O2/c1-7-13-20(14-8-2)24-30-25(21-15-10-9-11-16-21)32-26(31-24)22-17-12-18-23(19-22)29-33-27(3,4)28(5,6)34-29/h7-8,10,12-19H,1,9,11H2,2-6H3/b14-8-,20-13+ |
| InChIKey | ZGCCCJZHHBBRDK-YBUWFPGPSA-N |
| XLogP | 5.72 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|