C40H45BN4O2 — CID 142370257
(3Z,4E)-3,4-di(ethylidene)-9-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenyl-1,3,5-triazin-2-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;ethane (PubChem CID 142370257) has the molecular formula C40H45BN4O2 and a molecular weight of 624.64 g/mol. Its IUPAC name is (3Z,4E)-3,4-di(ethylidene)-9-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenyl-1,3,5-triazin-2-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;ethane.
| Compound Name | (3Z,4E)-3,4-di(ethylidene)-9-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenyl-1,3,5-triazin-2-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;ethane |
|---|---|
| PubChem CID | 142370257 |
| Molecular Formula | C40H45BN4O2 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.36 |
| IUPAC Name | (3Z,4E)-3,4-di(ethylidene)-9-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenyl-1,3,5-triazin-2-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole;ethane |
| SMILES | C=C/C=C(\C=C/C)c1nc(-c2ccccc2)nc(-n2c3ccc(B4OC(C)(C)C(C)(C)O4)cc3c3c(=C/C)/c(=C\C)ccc32)n1.CC |
| InChI | InChI=1S/C38H39BN4O2.C2H6/c1-9-16-26(17-10-2)34-40-35(27-18-14-13-15-19-27)42-36(41-34)43-31-23-21-28(39-44-37(5,6)38(7,8)45-39)24-30(31)33-29(12-4)25(11-3)20-22-32(33)43;1-2/h9-24H,1H2,2-8H3;1-2H3/b17-10-,25-11-,26-16+,29-12+; |
| InChIKey | FCSJCYDXFBHZDL-FHHDTDOGSA-N |
| XLogP | 7.71 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|