C40H28N4O2 — CID 155131112
8-[9-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazol-3-yl]benzo[c]chromen-6-one (PubChem CID 155131112) has the molecular formula C40H28N4O2 and a molecular weight of 596.69 g/mol. Its IUPAC name is 8-[9-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazol-3-yl]benzo[c]chromen-6-one.
| Compound Name | 8-[9-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazol-3-yl]benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 155131112 |
| Molecular Formula | C40H28N4O2 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 8-[9-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazol-3-yl]benzo[c]chromen-6-one |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-n2c3ccccc3c3cc(-c4ccc5c(c4)c(=O)oc4ccccc45)ccc32)n1 |
| InChI | InChI=1S/C40H28N4O2/c1-3-12-25(4-2)37-41-38(26-13-6-5-7-14-26)43-40(42-37)44-34-17-10-8-15-30(34)32-23-28(20-22-35(32)44)27-19-21-29-31-16-9-11-18-36(31)46-39(45)33(29)24-27/h3-24H,1-2H3/b12-3-,25-4+ |
| InChIKey | MQAKCCBWBKYBOH-HYXJCTBNSA-N |
| XLogP | 9.54 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|