C54H32N8O — CID 146573160
12-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-a]carbazole (PubChem CID 146573160) has the molecular formula C54H32N8O and a molecular weight of 808.91 g/mol. Its IUPAC name is 12-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-a]carbazole.
| Compound Name | 12-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-a]carbazole |
|---|---|
| PubChem CID | 146573160 |
| Molecular Formula | C54H32N8O |
| Molecular Weight | 808.91 g/mol |
| Exact Mass | 808.27 |
| IUPAC Name | 12-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-a]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4cc(-c5nc(-c6ccccc6)nc(-n6c7ccccc7c7ccc8c9ccccc9oc8c76)n5)ccc43)n2)cc1 |
| InChI | InChI=1S/C54H32N8O/c1-4-16-33(17-5-1)49-55-50(34-18-6-2-7-19-34)58-53(57-49)61-43-25-13-11-23-38(43)42-32-36(28-31-45(42)61)52-56-51(35-20-8-3-9-21-35)59-54(60-52)62-44-26-14-10-22-37(44)40-29-30-41-39-24-12-15-27-46(39)63-48(41)47(40)62/h1-32H |
| InChIKey | BCPSGHKEGUIHPV-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.91 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |