C39H24N4O — CID 164757804
12-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenyl-[1]benzofuro[2,3-a]carbazole (PubChem CID 164757804) has the molecular formula C39H24N4O and a molecular weight of 564.65 g/mol. Its IUPAC name is 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenyl-[1]benzofuro[2,3-a]carbazole.
| Compound Name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenyl-[1]benzofuro[2,3-a]carbazole |
|---|---|
| PubChem CID | 164757804 |
| Molecular Formula | C39H24N4O |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-phenyl-[1]benzofuro[2,3-a]carbazole |
| SMILES | c1ccc(-c2ccc3oc4c(ccc5c6ccccc6n(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c54)c3c2)cc1 |
| InChI | InChI=1S/C39H24N4O/c1-4-12-25(13-5-1)28-20-23-34-32(24-28)31-22-21-30-29-18-10-11-19-33(29)43(35(30)36(31)44-34)39-41-37(26-14-6-2-7-15-26)40-38(42-39)27-16-8-3-9-17-27/h1-24H |
| InChIKey | YRSSDGSSYUDBIR-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |