C44H42BN3O2 — CID 142461155
(3Z,4E)-9-[4-(4-phenylphenyl)quinazolin-2-yl]-3,4-di(propylidene)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole (PubChem CID 142461155) has the molecular formula C44H42BN3O2 and a molecular weight of 655.65 g/mol. Its IUPAC name is (3Z,4E)-9-[4-(4-phenylphenyl)quinazolin-2-yl]-3,4-di(propylidene)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole.
| Compound Name | (3Z,4E)-9-[4-(4-phenylphenyl)quinazolin-2-yl]-3,4-di(propylidene)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| PubChem CID | 142461155 |
| Molecular Formula | C44H42BN3O2 |
| Molecular Weight | 655.65 g/mol |
| Exact Mass | 655.34 |
| IUPAC Name | (3Z,4E)-9-[4-(4-phenylphenyl)quinazolin-2-yl]-3,4-di(propylidene)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
| SMILES | CC/C=c1/ccc2c(/c1=C/CC)c1cc(B3OC(C)(C)C(C)(C)O3)ccc1n2-c1nc(-c2ccc(-c3ccccc3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C44H42BN3O2/c1-7-14-31-24-26-39-40(34(31)15-8-2)36-28-33(45-49-43(3,4)44(5,6)50-45)25-27-38(36)48(39)42-46-37-19-13-12-18-35(37)41(47-42)32-22-20-30(21-23-32)29-16-10-9-11-17-29/h9-28H,7-8H2,1-6H3/b31-14-,34-15+ |
| InChIKey | UIWFWDHOBIFKQM-GSYLRHPGSA-N |
| XLogP | 8.74 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.65 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|