C13H13NO — CID 142912112
N-cyclohepta-1,3,6-trien-1-yl-N-phenylhydroxylamine (PubChem CID 142912112) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is N-cyclohepta-1,3,6-trien-1-yl-N-phenylhydroxylamine.
| Compound Name | N-cyclohepta-1,3,6-trien-1-yl-N-phenylhydroxylamine |
|---|---|
| PubChem CID | 142912112 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N-cyclohepta-1,3,6-trien-1-yl-N-phenylhydroxylamine |
| SMILES | ON(C1=CC=CCC=C1)c1ccccc1 |
| InChI | InChI=1S/C13H13NO/c15-14(13-10-6-3-7-11-13)12-8-4-1-2-5-9-12/h1,3-11,15H,2H2 |
| InChIKey | JTZCGWRNXBQXNH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|