C50H49N3 — CID 129146041
1-N,5-N-di(cyclohepta-1,3,6-trien-1-yl)-2,4,6-triethyl-1-N,3-N,3-N,5-N-tetraphenylbenzene-1,3,5-triamine (PubChem CID 129146041) has the molecular formula C50H49N3 and a molecular weight of 691.96 g/mol. Its IUPAC name is 1-N,5-N-di(cyclohepta-1,3,6-trien-1-yl)-2,4,6-triethyl-1-N,3-N,3-N,5-N-tetraphenylbenzene-1,3,5-triamine.
| Compound Name | 1-N,5-N-di(cyclohepta-1,3,6-trien-1-yl)-2,4,6-triethyl-1-N,3-N,3-N,5-N-tetraphenylbenzene-1,3,5-triamine |
|---|---|
| PubChem CID | 129146041 |
| Molecular Formula | C50H49N3 |
| Molecular Weight | 691.96 g/mol |
| Exact Mass | 691.39 |
| IUPAC Name | 1-N,5-N-di(cyclohepta-1,3,6-trien-1-yl)-2,4,6-triethyl-1-N,3-N,3-N,5-N-tetraphenylbenzene-1,3,5-triamine |
| SMILES | CCc1c(N(C2=CC=CCC=C2)c2ccccc2)c(CC)c(N(c2ccccc2)c2ccccc2)c(CC)c1N(C1=CC=CCC=C1)c1ccccc1 |
| InChI | InChI=1S/C50H49N3/c1-4-45-48(51(41-31-19-11-20-32-41)39-27-15-7-8-16-28-39)46(5-2)50(53(43-35-23-13-24-36-43)44-37-25-14-26-38-44)47(6-3)49(45)52(42-33-21-12-22-34-42)40-29-17-9-10-18-30-40/h7,9,11-38H,4-6,8,10H2,1-3H3 |
| InChIKey | NVQHKIKQXLQKDP-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.96 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |