C33H32N2 — CID 142961369
(1E,6Z)-1-N-cyclohepta-1,3,6-trien-1-yl-1-N,5-N,5-N-triphenylocta-1,3,6-triene-1,5-diamine (PubChem CID 142961369) has the molecular formula C33H32N2 and a molecular weight of 456.63 g/mol. Its IUPAC name is (1E,6Z)-1-N-cyclohepta-1,3,6-trien-1-yl-1-N,5-N,5-N-triphenylocta-1,3,6-triene-1,5-diamine.
| Compound Name | (1E,6Z)-1-N-cyclohepta-1,3,6-trien-1-yl-1-N,5-N,5-N-triphenylocta-1,3,6-triene-1,5-diamine |
|---|---|
| PubChem CID | 142961369 |
| Molecular Formula | C33H32N2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | (1E,6Z)-1-N-cyclohepta-1,3,6-trien-1-yl-1-N,5-N,5-N-triphenylocta-1,3,6-triene-1,5-diamine |
| SMILES | C/C=C\C(C=C/C=C/N(C1=CC=CCC=C1)c1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H32N2/c1-2-18-31(35(32-23-12-6-13-24-32)33-25-14-7-15-26-33)27-16-17-28-34(30-21-10-5-11-22-30)29-19-8-3-4-9-20-29/h2-3,5-28,31H,4H2,1H3/b18-2-,27-16?,28-17+ |
| InChIKey | FZUWJFBHADJKQB-JZAOFHFKSA-N |
| XLogP | 8.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|