C45H38N2 — CID 143144037
N-[4-[4-[4-[cyclohepta-1,3,6-trien-1-yl(cyclohepta-1,4,6-trien-1-yl)amino]phenyl]phenyl]phenyl]-N-phenylbicyclo[4.1.0]hepta-2,4-dien-3-amine (PubChem CID 143144037) has the molecular formula C45H38N2 and a molecular weight of 606.81 g/mol. Its IUPAC name is N-[4-[4-[4-[cyclohepta-1,3,6-trien-1-yl(cyclohepta-1,4,6-trien-1-yl)amino]phenyl]phenyl]phenyl]-N-phenylbicyclo[4.1.0]hepta-2,4-dien-3-amine.
| Compound Name | N-[4-[4-[4-[cyclohepta-1,3,6-trien-1-yl(cyclohepta-1,4,6-trien-1-yl)amino]phenyl]phenyl]phenyl]-N-phenylbicyclo[4.1.0]hepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 143144037 |
| Molecular Formula | C45H38N2 |
| Molecular Weight | 606.81 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | N-[4-[4-[4-[cyclohepta-1,3,6-trien-1-yl(cyclohepta-1,4,6-trien-1-yl)amino]phenyl]phenyl]phenyl]-N-phenylbicyclo[4.1.0]hepta-2,4-dien-3-amine |
| SMILES | C1=CCC=CC(N(C2=CCC=CC=C2)c2ccc(-c3ccc(-c4ccc(N(C5=CC6CC6C=C5)c5ccccc5)cc4)cc3)cc2)=C1 |
| InChI | InChI=1S/C45H38N2/c1-2-7-13-40(12-6-1)46(41-14-8-3-4-9-15-41)43-27-22-36(23-28-43)34-18-20-35(21-19-34)37-24-29-44(30-25-37)47(42-16-10-5-11-17-42)45-31-26-38-32-39(38)33-45/h1-3,5-6,8-31,33,38-39H,4,7,32H2 |
| InChIKey | WKUNVRLEVDFDLW-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.81 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |