C16H18 — CID 91047474
3-(2-phenylpropan-2-yl)cyclohepta-1,3,5-triene (PubChem CID 91047474) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-(2-phenylpropan-2-yl)cyclohepta-1,3,5-triene.
| Compound Name | 3-(2-phenylpropan-2-yl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 91047474 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-(2-phenylpropan-2-yl)cyclohepta-1,3,5-triene |
| SMILES | CC(C)(C1=CC=CCC=C1)c1ccccc1 |
| InChI | InChI=1S/C16H18/c1-16(2,15-12-8-5-9-13-15)14-10-6-3-4-7-11-14/h3,5-13H,4H2,1-2H3 |
| InChIKey | CJFASTGERMCNMO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |