C15H21N — CID 163749206
1-cyclohepta-1,3,6-trien-1-yl-1-cyclohex-3-en-1-ylethanamine (PubChem CID 163749206) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-cyclohepta-1,3,6-trien-1-yl-1-cyclohex-3-en-1-ylethanamine.
| Compound Name | 1-cyclohepta-1,3,6-trien-1-yl-1-cyclohex-3-en-1-ylethanamine |
|---|---|
| PubChem CID | 163749206 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-cyclohepta-1,3,6-trien-1-yl-1-cyclohex-3-en-1-ylethanamine |
| SMILES | CC(N)(C1=CC=CCC=C1)C1CC=CCC1 |
| InChI | InChI=1S/C15H21N/c1-15(16,14-11-7-4-8-12-14)13-9-5-2-3-6-10-13/h2,4-7,9-10,14H,3,8,11-12,16H2,1H3 |
| InChIKey | LONPHFWCAWEVEO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|