C22H40 — CID 167642052
1-tert-butyl-1,2,3,3a,4,5,6,6a-octahydropentalene;4-tert-butylcyclohexene (PubChem CID 167642052) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is 1-tert-butyl-1,2,3,3a,4,5,6,6a-octahydropentalene;4-tert-butylcyclohexene.
| Compound Name | 1-tert-butyl-1,2,3,3a,4,5,6,6a-octahydropentalene;4-tert-butylcyclohexene |
|---|---|
| PubChem CID | 167642052 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 1-tert-butyl-1,2,3,3a,4,5,6,6a-octahydropentalene;4-tert-butylcyclohexene |
| SMILES | CC(C)(C)C1CC=CCC1.CC(C)(C)C1CCC2CCCC21 |
| InChI | InChI=1S/C12H22.C10H18/c1-12(2,3)11-8-7-9-5-4-6-10(9)11;1-10(2,3)9-7-5-4-6-8-9/h9-11H,4-8H2,1-3H3;4-5,9H,6-8H2,1-3H3 |
| InChIKey | PHLVBIWMCXJFGJ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|