About boric acid;4-tert-butylcyclohexene
boric acid;4-tert-butylcyclohexene (PubChem CID 161132440) has the molecular formula C10H21BO3
and a molecular weight of 200.09 g/mol. Its IUPAC name is boric acid;4-tert-butylcyclohexene.
Molecular Properties
| Compound Name | boric acid;4-tert-butylcyclohexene |
| PubChem CID | 161132440 |
| Molecular Formula | C10H21BO3 |
| Molecular Weight | 200.09 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | boric acid;4-tert-butylcyclohexene |
| SMILES | CC(C)(C)C1CC=CCC1.OB(O)O |
| InChI | InChI=1S/C10H18.BH3O3/c1-10(2,3)9-7-5-4-6-8-9;2-1(3)4/h4-5,9H,6-8H2,1-3H3;2-4H |
| InChIKey | UMJHGSKXTXRYGN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.09 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze boric acid;4-tert-butylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;4-tert-butylcyclohexene?
The IUPAC name of boric acid;4-tert-butylcyclohexene (CID 161132440) is boric acid;4-tert-butylcyclohexene.
What is the SMILES notation for boric acid;4-tert-butylcyclohexene?
The canonical SMILES for boric acid;4-tert-butylcyclohexene is CC(C)(C)C1CC=CCC1.OB(O)O.
What is the InChIKey of boric acid;4-tert-butylcyclohexene?
The InChIKey is UMJHGSKXTXRYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18.BH3O3/c1-10(2,3)9-7-5-4-6-8-9;2-1(3)4/h4-5,9H,6-8H2,1-3H3;2-4H.
What are the key properties of boric acid;4-tert-butylcyclohexene?
boric acid;4-tert-butylcyclohexene has a molecular weight of 200.09 g/mol, XLogP of 1.34, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;4-tert-butylcyclohexene is sourced from PubChem (CID 161132440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).