C14H24O — CID 58281125
1-[(4Z)-cyclooct-4-en-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 58281125) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 1-[(4Z)-cyclooct-4-en-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[(4Z)-cyclooct-4-en-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 58281125 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1-[(4Z)-cyclooct-4-en-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)C1CC/C=C\CCC1 |
| InChI | InChI=1S/C14H24O/c1-14(2,3)11-13(15)12-9-7-5-4-6-8-10-12/h4-5,12H,6-11H2,1-3H3/b5-4- |
| InChIKey | PROQYPOWAFVXBL-PLNGDYQASA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|