C13H25NO — CID 106185997
3-(cyclohex-3-en-1-ylmethylamino)-2,3-dimethylbutan-2-ol (PubChem CID 106185997) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 3-(cyclohex-3-en-1-ylmethylamino)-2,3-dimethylbutan-2-ol.
| Compound Name | 3-(cyclohex-3-en-1-ylmethylamino)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 106185997 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 3-(cyclohex-3-en-1-ylmethylamino)-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)NCC1CC=CCC1 |
| InChI | InChI=1S/C13H25NO/c1-12(2,13(3,4)15)14-10-11-8-6-5-7-9-11/h5-6,11,14-15H,7-10H2,1-4H3 |
| InChIKey | HZFGEWJYIUWPPT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|