C13H24N2O — CID 97240049
2-[[(1S)-cyclohex-3-en-1-yl]methylamino]-N,N,2-trimethylpropanamide (PubChem CID 97240049) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-[[(1S)-cyclohex-3-en-1-yl]methylamino]-N,N,2-trimethylpropanamide.
| Compound Name | 2-[[(1S)-cyclohex-3-en-1-yl]methylamino]-N,N,2-trimethylpropanamide |
|---|---|
| PubChem CID | 97240049 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-[[(1S)-cyclohex-3-en-1-yl]methylamino]-N,N,2-trimethylpropanamide |
| SMILES | CN(C)C(=O)C(C)(C)NC[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C13H24N2O/c1-13(2,12(16)15(3)4)14-10-11-8-6-5-7-9-11/h5-6,11,14H,7-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | MPCJJSIILVUAIR-LLVKDONJSA-N |
| XLogP | 1.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|