C9H13F2NO — CID 103515679
N-(cyclohex-3-en-1-ylmethyl)-2,2-difluoroacetamide (PubChem CID 103515679) has the molecular formula C9H13F2NO and a molecular weight of 189.21 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-2,2-difluoroacetamide.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103515679 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-2,2-difluoroacetamide |
| SMILES | O=C(NCC1CC=CCC1)C(F)F |
| InChI | InChI=1S/C9H13F2NO/c10-8(11)9(13)12-6-7-4-2-1-3-5-7/h1-2,7-8H,3-6H2,(H,12,13) |
| InChIKey | RQXPAESOIJAOPU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|