C12H20N2O3 — CID 64888191
4-amino-5-(cyclohex-3-en-1-ylmethylamino)-5-oxopentanoic acid (PubChem CID 64888191) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-amino-5-(cyclohex-3-en-1-ylmethylamino)-5-oxopentanoic acid.
| Compound Name | 4-amino-5-(cyclohex-3-en-1-ylmethylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 64888191 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-amino-5-(cyclohex-3-en-1-ylmethylamino)-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)O)C(=O)NCC1CC=CCC1 |
| InChI | InChI=1S/C12H20N2O3/c13-10(6-7-11(15)16)12(17)14-8-9-4-2-1-3-5-9/h1-2,9-10H,3-8,13H2,(H,14,17)(H,15,16) |
| InChIKey | NYRZJNALYLVEKF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|