About 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene
11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene (PubChem CID 123568593) has the molecular formula C20H38
and a molecular weight of 278.52 g/mol. Its IUPAC name is 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene.
Molecular Properties
| Compound Name | 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene |
| PubChem CID | 123568593 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene |
| SMILES | CC1CC=CCCC(C(C)(C)C(C)C)CCCCCC1 |
| InChI | InChI=1S/C20H38/c1-17(2)20(4,5)19-15-11-7-6-9-13-18(3)14-10-8-12-16-19/h8,10,17-19H,6-7,9,11-16H2,1-5H3 |
| InChIKey | MUBYPYCBYNBUJX-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene?
The IUPAC name of 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene (CID 123568593) is 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene.
What is the SMILES notation for 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene?
The canonical SMILES for 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene is CC1CC=CCCC(C(C)(C)C(C)C)CCCCCC1.
What is the InChIKey of 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene?
The InChIKey is MUBYPYCBYNBUJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38/c1-17(2)20(4,5)19-15-11-7-6-9-13-18(3)14-10-8-12-16-19/h8,10,17-19H,6-7,9,11-16H2,1-5H3.
What are the key properties of 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene?
11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene has a molecular weight of 278.52 g/mol, XLogP of 7.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(2,3-dimethylbutan-2-yl)-4-methylcyclotridecene is sourced from PubChem (CID 123568593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).