About 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane
4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane (PubChem CID 142139515) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane.
Analyze 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane?
The IUPAC name of 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane (CID 142139515) is 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane.
What is the SMILES notation for 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane?
The canonical SMILES for 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane is CC(C)C(C)(C)C1CCC(C)(C)CC1.
What is the InChIKey of 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane?
The InChIKey is IGMHXQYEUBVWJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28/c1-11(2)14(5,6)12-7-9-13(3,4)10-8-12/h11-12H,7-10H2,1-6H3.
What are the key properties of 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane?
4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane has a molecular weight of 196.38 g/mol, XLogP of 4.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylbutan-2-yl)-1,1-dimethylcyclohexane is sourced from PubChem (CID 142139515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).