C20H20Si — CID 144923038
cyclohepta-1,3,6-trien-1-yl-methyl-diphenylsilane (PubChem CID 144923038) has the molecular formula C20H20Si and a molecular weight of 288.47 g/mol. Its IUPAC name is cyclohepta-1,3,6-trien-1-yl-methyl-diphenylsilane.
| Compound Name | cyclohepta-1,3,6-trien-1-yl-methyl-diphenylsilane |
|---|---|
| PubChem CID | 144923038 |
| Molecular Formula | C20H20Si |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | cyclohepta-1,3,6-trien-1-yl-methyl-diphenylsilane |
| SMILES | C[Si](C1=CC=CCC=C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20Si/c1-21(19-14-8-4-9-15-19,20-16-10-5-11-17-20)18-12-6-2-3-7-13-18/h2,4-17H,3H2,1H3 |
| InChIKey | NFHZIYYGGRIWIV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|