C22H30OSi2 — CID 6431655
cyclopenta-1,3-diene;dimethyl-(4-phenylphenyl)-trimethylsilyloxysilane (PubChem CID 6431655) has the molecular formula C22H30OSi2 and a molecular weight of 366.65 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dimethyl-(4-phenylphenyl)-trimethylsilyloxysilane.
| Compound Name | cyclopenta-1,3-diene;dimethyl-(4-phenylphenyl)-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 6431655 |
| Molecular Formula | C22H30OSi2 |
| Molecular Weight | 366.65 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | cyclopenta-1,3-diene;dimethyl-(4-phenylphenyl)-trimethylsilyloxysilane |
| SMILES | C1=CCC=C1.C[Si](C)(C)O[Si](C)(C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H24OSi2.C5H6/c1-19(2,3)18-20(4,5)17-13-11-16(12-14-17)15-9-7-6-8-10-15;1-2-4-5-3-1/h6-14H,1-5H3;1-4H,5H2 |
| InChIKey | CLCYYGKNBVMZDZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|