C20H28S — CID 91361276
cyclopenta-1,3-diene;ethane;2-methyl-5-phenylthiophene (PubChem CID 91361276) has the molecular formula C20H28S and a molecular weight of 300.51 g/mol. Its IUPAC name is cyclopenta-1,3-diene;ethane;2-methyl-5-phenylthiophene.
| Compound Name | cyclopenta-1,3-diene;ethane;2-methyl-5-phenylthiophene |
|---|---|
| PubChem CID | 91361276 |
| Molecular Formula | C20H28S |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | cyclopenta-1,3-diene;ethane;2-methyl-5-phenylthiophene |
| SMILES | C1=CCC=C1.CC.CC.Cc1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C11H10S.C5H6.2C2H6/c1-9-7-8-11(12-9)10-5-3-2-4-6-10;1-2-4-5-3-1;2*1-2/h2-8H,1H3;1-4H,5H2;2*1-2H3 |
| InChIKey | XAKZVKPQKUCNBC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |