C19H15N — CID 163547721
N,N-diphenylcyclohepta-1,6-dien-3-yn-1-amine (PubChem CID 163547721) has the molecular formula C19H15N and a molecular weight of 257.34 g/mol. Its IUPAC name is N,N-diphenylcyclohepta-1,6-dien-3-yn-1-amine.
| Compound Name | N,N-diphenylcyclohepta-1,6-dien-3-yn-1-amine |
|---|---|
| PubChem CID | 163547721 |
| Molecular Formula | C19H15N |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N,N-diphenylcyclohepta-1,6-dien-3-yn-1-amine |
| SMILES | C1#CCC=CC(N(c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C19H15N/c1-2-6-12-17(11-5-1)20(18-13-7-3-8-14-18)19-15-9-4-10-16-19/h3-5,7-16H,1H2 |
| InChIKey | FGLQGFBBTCCTEA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|