About cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate
cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate (PubChem CID 174818615) has the molecular formula C14H19F6P
and a molecular weight of 332.27 g/mol. Its IUPAC name is cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate.
Molecular Properties
| Compound Name | cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate |
| PubChem CID | 174818615 |
| Molecular Formula | C14H19F6P |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate |
| SMILES | C1=CCC=C1.CC(C)c1ccccc1.F[P-](F)(F)(F)(F)F.[H+] |
| InChI | InChI=1S/C9H12.C5H6.F6P/c1-8(2)9-6-4-3-5-7-9;1-2-4-5-3-1;1-7(2,3,4,5)6/h3-8H,1-2H3;1-4H,5H2;/q;;-1/p+1 |
| InChIKey | YBOWHPISHPTBSR-UHFFFAOYSA-O |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate?
The IUPAC name of cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate (CID 174818615) is cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate.
What is the SMILES notation for cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate?
The canonical SMILES for cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate is C1=CCC=C1.CC(C)c1ccccc1.F[P-](F)(F)(F)(F)F.[H+].
What is the InChIKey of cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate?
The InChIKey is YBOWHPISHPTBSR-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H12.C5H6.F6P/c1-8(2)9-6-4-3-5-7-9;1-2-4-5-3-1;1-7(2,3,4,5)6/h3-8H,1-2H3;1-4H,5H2;/q;;-1/p+1.
What are the key properties of cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate?
cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate has a molecular weight of 332.27 g/mol, XLogP of 7.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;cyclopenta-1,3-diene;hydron;hexafluorophosphate is sourced from PubChem (CID 174818615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).