C7H10N2 — CID 142980862
(4-methylcyclohexa-1,5-dien-1-yl)diazene (PubChem CID 142980862) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is (4-methylcyclohexa-1,5-dien-1-yl)diazene.
| Compound Name | (4-methylcyclohexa-1,5-dien-1-yl)diazene |
|---|---|
| PubChem CID | 142980862 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | (4-methylcyclohexa-1,5-dien-1-yl)diazene |
| SMILES | [H]/N=N/C1=CCC(C)C=C1 |
| InChI | InChI=1S/C7H10N2/c1-6-2-4-7(9-8)5-3-6/h2,4-6,8H,3H2,1H3/b9-8+ |
| InChIKey | OXIRMCMFOHICAK-CMDGGOBGSA-N |
| XLogP | 2.50 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|