C8H11N — CID 123434300
4-methylcyclohepta-2,6-dien-1-imine (PubChem CID 123434300) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 4-methylcyclohepta-2,6-dien-1-imine.
| Compound Name | 4-methylcyclohepta-2,6-dien-1-imine |
|---|---|
| PubChem CID | 123434300 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 4-methylcyclohepta-2,6-dien-1-imine |
| SMILES | [H]/N=C1\C=CCC(C)C=C1 |
| InChI | InChI=1S/C8H11N/c1-7-3-2-4-8(9)6-5-7/h2,4-7,9H,3H2,1H3/b9-8+ |
| InChIKey | FIPHUBXZWIFFOP-CMDGGOBGSA-N |
| XLogP | 2.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|