C13H18 — CID 123382258
3-but-2-en-2-yl-8-methylcycloocta-1,3,5-triene (PubChem CID 123382258) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 3-but-2-en-2-yl-8-methylcycloocta-1,3,5-triene.
| Compound Name | 3-but-2-en-2-yl-8-methylcycloocta-1,3,5-triene |
|---|---|
| PubChem CID | 123382258 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3-but-2-en-2-yl-8-methylcycloocta-1,3,5-triene |
| SMILES | CC=C(C)C1=CC=CCC(C)C=C1 |
| InChI | InChI=1S/C13H18/c1-4-12(3)13-8-6-5-7-11(2)9-10-13/h4-6,8-11H,7H2,1-3H3 |
| InChIKey | ULIRBGZIHLLUMB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |