C15H20 — CID 144719031
6-methyl-1-[(3Z)-3-prop-1-en-2-ylpenta-1,3-dien-2-yl]cyclohexa-1,3-diene (PubChem CID 144719031) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 6-methyl-1-[(3Z)-3-prop-1-en-2-ylpenta-1,3-dien-2-yl]cyclohexa-1,3-diene.
| Compound Name | 6-methyl-1-[(3Z)-3-prop-1-en-2-ylpenta-1,3-dien-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144719031 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 6-methyl-1-[(3Z)-3-prop-1-en-2-ylpenta-1,3-dien-2-yl]cyclohexa-1,3-diene |
| SMILES | C=C(C)/C(=C/C)C(=C)C1=CC=CCC1C |
| InChI | InChI=1S/C15H20/c1-6-14(11(2)3)13(5)15-10-8-7-9-12(15)4/h6-8,10,12H,2,5,9H2,1,3-4H3/b14-6- |
| InChIKey | OTCYMUMBXUJVDR-NSIKDUERSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|