C9H14O — CID 155053244
2-(6-methylcyclohexa-1,3-dien-1-yl)ethanol (PubChem CID 155053244) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-(6-methylcyclohexa-1,3-dien-1-yl)ethanol.
| Compound Name | 2-(6-methylcyclohexa-1,3-dien-1-yl)ethanol |
|---|---|
| PubChem CID | 155053244 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 2-(6-methylcyclohexa-1,3-dien-1-yl)ethanol |
| SMILES | CC1CC=CC=C1CCO |
| InChI | InChI=1S/C9H14O/c1-8-4-2-3-5-9(8)6-7-10/h2-3,5,8,10H,4,6-7H2,1H3 |
| InChIKey | BCSHSLWBKJLLAC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |