C11H18 — CID 142008819
(6R)-1-butan-2-yl-6-methylcyclohexa-1,3-diene (PubChem CID 142008819) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (6R)-1-butan-2-yl-6-methylcyclohexa-1,3-diene.
| Compound Name | (6R)-1-butan-2-yl-6-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142008819 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (6R)-1-butan-2-yl-6-methylcyclohexa-1,3-diene |
| SMILES | CCC(C)C1=CC=CC[C@H]1C |
| InChI | InChI=1S/C11H18/c1-4-9(2)11-8-6-5-7-10(11)3/h5-6,8-10H,4,7H2,1-3H3/t9?,10-/m1/s1 |
| InChIKey | IKGVGRRCHBFMDF-QVDQXJPCSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |