About 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene
1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene (PubChem CID 169222897) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene.
Analyze 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene?
The IUPAC name of 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene (CID 169222897) is 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene.
What is the SMILES notation for 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene?
The canonical SMILES for 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene is CCC(C)C1=CC=CC1CC(C)C.
What is the InChIKey of 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene?
The InChIKey is RPLABIIMHNGSJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-5-11(4)13-8-6-7-12(13)9-10(2)3/h6-8,10-12H,5,9H2,1-4H3.
What are the key properties of 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene?
1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene has a molecular weight of 178.32 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-5-(2-methylpropyl)cyclopenta-1,3-diene is sourced from PubChem (CID 169222897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).