C31H34 — CID 141345898
1-[(2-butan-2-ylcyclopenta-2,4-dien-1-yl)-bis(3-methylphenyl)methyl]-3-methylbenzene (PubChem CID 141345898) has the molecular formula C31H34 and a molecular weight of 406.61 g/mol. Its IUPAC name is 1-[(2-butan-2-ylcyclopenta-2,4-dien-1-yl)-bis(3-methylphenyl)methyl]-3-methylbenzene.
| Compound Name | 1-[(2-butan-2-ylcyclopenta-2,4-dien-1-yl)-bis(3-methylphenyl)methyl]-3-methylbenzene |
|---|---|
| PubChem CID | 141345898 |
| Molecular Formula | C31H34 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-[(2-butan-2-ylcyclopenta-2,4-dien-1-yl)-bis(3-methylphenyl)methyl]-3-methylbenzene |
| SMILES | CCC(C)C1=CC=CC1C(c1cccc(C)c1)(c1cccc(C)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C31H34/c1-6-25(5)29-17-10-18-30(29)31(26-14-7-11-22(2)19-26,27-15-8-12-23(3)20-27)28-16-9-13-24(4)21-28/h7-21,25,30H,6H2,1-5H3 |
| InChIKey | SHIYEBICCKLJOG-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|