C10H15NO4 — CID 91050796
2-amino-1-(3-methylphenyl)propane-1,1,3,3-tetrol (PubChem CID 91050796) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-amino-1-(3-methylphenyl)propane-1,1,3,3-tetrol.
| Compound Name | 2-amino-1-(3-methylphenyl)propane-1,1,3,3-tetrol |
|---|---|
| PubChem CID | 91050796 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-amino-1-(3-methylphenyl)propane-1,1,3,3-tetrol |
| SMILES | Cc1cccc(C(O)(O)C(N)C(O)O)c1 |
| InChI | InChI=1S/C10H15NO4/c1-6-3-2-4-7(5-6)10(14,15)8(11)9(12)13/h2-5,8-9,12-15H,11H2,1H3 |
| InChIKey | JQKCJZWMGHWTKZ-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|