C12H16 — CID 102596704
butan-2-ylcyclooctatetraene (PubChem CID 102596704) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is butan-2-ylcyclooctatetraene.
| Compound Name | butan-2-ylcyclooctatetraene |
|---|---|
| PubChem CID | 102596704 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | butan-2-ylcyclooctatetraene |
| SMILES | CCC(C)C1=C/C=C\C=C/C=C\1 |
| InChI | InChI=1S/C12H16/c1-3-11(2)12-9-7-5-4-6-8-10-12/h4-11H,3H2,1-2H3/b5-4-,6-4-,7-5-,8-6-,9-7-,10-8-,12-9+,12-10+ |
| InChIKey | OOVOIGGSCJNIHF-LDTRLWGLSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |