C12H20S — CID 89217006
2,5-di(butan-2-yl)thiophene (PubChem CID 89217006) has the molecular formula C12H20S and a molecular weight of 196.36 g/mol. Its IUPAC name is 2,5-di(butan-2-yl)thiophene.
| Compound Name | 2,5-di(butan-2-yl)thiophene |
|---|---|
| PubChem CID | 89217006 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2,5-di(butan-2-yl)thiophene |
| SMILES | CCC(C)c1ccc(C(C)CC)s1 |
| InChI | InChI=1S/C12H20S/c1-5-9(3)11-7-8-12(13-11)10(4)6-2/h7-10H,5-6H2,1-4H3 |
| InChIKey | ARGBFUQGBYZGAZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |