C11H17BrO2S — CID 83935051
6-(5-bromothiophen-2-yl)heptane-3,4-diol (PubChem CID 83935051) has the molecular formula C11H17BrO2S and a molecular weight of 293.23 g/mol. Its IUPAC name is 6-(5-bromothiophen-2-yl)heptane-3,4-diol.
| Compound Name | 6-(5-bromothiophen-2-yl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83935051 |
| Molecular Formula | C11H17BrO2S |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 6-(5-bromothiophen-2-yl)heptane-3,4-diol |
| SMILES | CCC(O)C(O)CC(C)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H17BrO2S/c1-3-8(13)9(14)6-7(2)10-4-5-11(12)15-10/h4-5,7-9,13-14H,3,6H2,1-2H3 |
| InChIKey | KEXJBCLXUUVAPP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |