C8H13BrN2S — CID 116933230
1-(5-bromothiophen-2-yl)butane-1,3-diamine (PubChem CID 116933230) has the molecular formula C8H13BrN2S and a molecular weight of 249.18 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)butane-1,3-diamine.
| Compound Name | 1-(5-bromothiophen-2-yl)butane-1,3-diamine |
|---|---|
| PubChem CID | 116933230 |
| Molecular Formula | C8H13BrN2S |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)butane-1,3-diamine |
| SMILES | CC(N)CC(N)c1ccc(Br)s1 |
| InChI | InChI=1S/C8H13BrN2S/c1-5(10)4-6(11)7-2-3-8(9)12-7/h2-3,5-6H,4,10-11H2,1H3 |
| InChIKey | KFTPQZRGZJVTBD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |