C8H14BrClN2S — CID 171222508
(1S)-1-(5-bromothiophen-2-yl)butane-1,4-diamine;hydrochloride (PubChem CID 171222508) has the molecular formula C8H14BrClN2S and a molecular weight of 285.64 g/mol. Its IUPAC name is (1S)-1-(5-bromothiophen-2-yl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1S)-1-(5-bromothiophen-2-yl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171222508 |
| Molecular Formula | C8H14BrClN2S |
| Molecular Weight | 285.64 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | (1S)-1-(5-bromothiophen-2-yl)butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@H](N)c1ccc(Br)s1 |
| InChI | InChI=1S/C8H13BrN2S.ClH/c9-8-4-3-7(12-8)6(11)2-1-5-10;/h3-4,6H,1-2,5,10-11H2;1H/t6-;/m0./s1 |
| InChIKey | YHGCAMVJLGGLMV-RGMNGODLSA-N |
| XLogP | 2.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |