C8H11BrN2O2S — CID 61329171
2-[2-amino-2-(5-bromothiophen-2-yl)ethoxy]acetamide (PubChem CID 61329171) has the molecular formula C8H11BrN2O2S and a molecular weight of 279.16 g/mol. Its IUPAC name is 2-[2-amino-2-(5-bromothiophen-2-yl)ethoxy]acetamide.
| Compound Name | 2-[2-amino-2-(5-bromothiophen-2-yl)ethoxy]acetamide |
|---|---|
| PubChem CID | 61329171 |
| Molecular Formula | C8H11BrN2O2S |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | 2-[2-amino-2-(5-bromothiophen-2-yl)ethoxy]acetamide |
| SMILES | NC(=O)COCC(N)c1ccc(Br)s1 |
| InChI | InChI=1S/C8H11BrN2O2S/c9-7-2-1-6(14-7)5(10)3-13-4-8(11)12/h1-2,5H,3-4,10H2,(H2,11,12) |
| InChIKey | LPOXWJHBXWBOAE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |