C14H24O2S — CID 83929603
6-(5-propylthiophen-2-yl)heptane-3,4-diol (PubChem CID 83929603) has the molecular formula C14H24O2S and a molecular weight of 256.41 g/mol. Its IUPAC name is 6-(5-propylthiophen-2-yl)heptane-3,4-diol.
| Compound Name | 6-(5-propylthiophen-2-yl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83929603 |
| Molecular Formula | C14H24O2S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 6-(5-propylthiophen-2-yl)heptane-3,4-diol |
| SMILES | CCCc1ccc(C(C)CC(O)C(O)CC)s1 |
| InChI | InChI=1S/C14H24O2S/c1-4-6-11-7-8-14(17-11)10(3)9-13(16)12(15)5-2/h7-8,10,12-13,15-16H,4-6,9H2,1-3H3 |
| InChIKey | LRGAAVIWGASZRS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |