C11H20N2OS — CID 83929506
2,4-diamino-1-(5-propylthiophen-2-yl)butan-1-ol (PubChem CID 83929506) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 2,4-diamino-1-(5-propylthiophen-2-yl)butan-1-ol.
| Compound Name | 2,4-diamino-1-(5-propylthiophen-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 83929506 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2,4-diamino-1-(5-propylthiophen-2-yl)butan-1-ol |
| SMILES | CCCc1ccc(C(O)C(N)CCN)s1 |
| InChI | InChI=1S/C11H20N2OS/c1-2-3-8-4-5-10(15-8)11(14)9(13)6-7-12/h4-5,9,11,14H,2-3,6-7,12-13H2,1H3 |
| InChIKey | IFZZYSMDLIYRJC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |