C11H18O2S — CID 83929345
5-(5-methylthiophen-2-yl)hexane-2,3-diol (PubChem CID 83929345) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is 5-(5-methylthiophen-2-yl)hexane-2,3-diol.
| Compound Name | 5-(5-methylthiophen-2-yl)hexane-2,3-diol |
|---|---|
| PubChem CID | 83929345 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5-(5-methylthiophen-2-yl)hexane-2,3-diol |
| SMILES | Cc1ccc(C(C)CC(O)C(C)O)s1 |
| InChI | InChI=1S/C11H18O2S/c1-7(6-10(13)9(3)12)11-5-4-8(2)14-11/h4-5,7,9-10,12-13H,6H2,1-3H3 |
| InChIKey | UVBQIORFXNSKJT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |